CAS 26311-04-6 appears in our catalog under these names: Z-Cys(trt)-oh, 95%, Z-L-Cys(Trt)-OH, Cbz-Cys(Trt)-OH 97%, Z-Cys(Trt)-OH, 97%, 97%, (R)-2-(((Benzyloxy)carbonyl)amino)-3-(tritylthio)propanoic acid, 97%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100g, 10g.
(2R)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid (CAS 26311-04-6) is a chemical compound with the molecular formula C30H27NO4S and a molecular weight of 497.6 g/mol. IUPAC name: (2R)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid. InChIKey: AXGBGCZDGIBZPI-MHZLTWQESA-N.
| Molecular formula | C30H27NO4S |
|---|---|
| Molecular weight | 497.6 g/mol |
| IUPAC name | (2R)-2-(phenylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid |
| InChIKey | AXGBGCZDGIBZPI-MHZLTWQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CSC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)