Products 14003-11-3

CAS 14003-11-3 appears in our catalog under these names: 5-Methylfuran-2-carbonyl chloride, 95%, 5-METHYLFURAN-2-CARBONYL CHLORIDE, 97%. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-methylfuran-2-carbonyl chloride (CAS 14003-11-3) is a chemical compound with the molecular formula C6H5ClO2 and a molecular weight of 144.55 g/mol. IUPAC name: 5-methylfuran-2-carbonyl chloride. InChIKey: ZURUVZFDEVKNCE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClO2
Molecular weight144.55 g/mol
IUPAC name5-methylfuran-2-carbonyl chloride
InChIKeyZURUVZFDEVKNCE-UHFFFAOYSA-N
SMILESCC1=CC=C(O1)C(=O)Cl

Computed by PubChem (NCBI)