CAS 953390-32-4 is the registry number for 4-Chloro Resorcinol-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-diol (CAS 953390-32-4) is a chemical compound with the molecular formula C6H5ClO2 and a molecular weight of 150.51 g/mol. IUPAC name: 4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-diol. InChIKey: JQVAPEJNIZULEK-IDEBNGHGSA-N.
| Molecular formula | C6H5ClO2 |
|---|---|
| Molecular weight | 150.51 g/mol |
| IUPAC name | 4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-diol |
| InChIKey | JQVAPEJNIZULEK-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1O)O)Cl |
Computed by PubChem (NCBI)