Products 953390-32-4

CAS 953390-32-4 is the registry number for 4-Chloro Resorcinol-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.

Structural formula: {0} (CAS {1})

4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-diol (CAS 953390-32-4) is a chemical compound with the molecular formula C6H5ClO2 and a molecular weight of 150.51 g/mol. IUPAC name: 4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-diol. InChIKey: JQVAPEJNIZULEK-IDEBNGHGSA-N.

Identity
Molecular formulaC6H5ClO2
Molecular weight150.51 g/mol
IUPAC name4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-diol
InChIKeyJQVAPEJNIZULEK-IDEBNGHGSA-N
SMILES[13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1O)O)Cl

Computed by PubChem (NCBI)