CAS 1400645-30-8 is the registry number for Methyl 1-cyclopentyl-1,2,3-benzotriazole-5-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Methyl 1-cyclopentylbenzotriazole-5-carboxylate (CAS 1400645-30-8) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: methyl 1-cyclopentylbenzotriazole-5-carboxylate. InChIKey: IHTGNEMBMFZRCA-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | methyl 1-cyclopentylbenzotriazole-5-carboxylate |
| InChIKey | IHTGNEMBMFZRCA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)N(N=N2)C3CCCC3 |
Computed by PubChem (NCBI)