CAS 1400661-81-5 is the registry number for 5-(Methoxycarbonyl)-4-(trifluoromethyl)thiophene-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
5-methoxycarbonyl-4-(trifluoromethyl)thiophene-2-carboxylic acid (CAS 1400661-81-5) is a chemical compound with the molecular formula C8H5F3O4S and a molecular weight of 254.18 g/mol. IUPAC name: 5-methoxycarbonyl-4-(trifluoromethyl)thiophene-2-carboxylic acid. InChIKey: JCYDFTMULJQTNS-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O4S |
|---|---|
| Molecular weight | 254.18 g/mol |
| IUPAC name | 5-methoxycarbonyl-4-(trifluoromethyl)thiophene-2-carboxylic acid |
| InChIKey | JCYDFTMULJQTNS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)