CAS 952-69-2 appears in our catalog under these names: 3-Trifluoromethanesulfonylbenzoic acid, 95%, 3-(Trifluoromethylsulphonyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
3-(trifluoromethylsulfonyl)benzoic acid (CAS 952-69-2) is a chemical compound with the molecular formula C8H5F3O4S and a molecular weight of 254.18 g/mol. IUPAC name: 3-(trifluoromethylsulfonyl)benzoic acid. InChIKey: BUXMJMHFPYNLAJ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O4S |
|---|---|
| Molecular weight | 254.18 g/mol |
| IUPAC name | 3-(trifluoromethylsulfonyl)benzoic acid |
| InChIKey | BUXMJMHFPYNLAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)