Products 14007-45-5
CAS 14007-45-5 is the registry number for Potassium L-aspartate, 98%, 98%. Offered by: Chemat. Available pack sizes: 10g, 25g, 100g.
Dipotassium;(2S)-2-aminobutanedioate (CAS 14007-45-5) is a chemical compound with the molecular formula C4H5K2NO4 and a molecular weight of 209.28 g/mol. IUPAC name: dipotassium;(2S)-2-aminobutanedioate. InChIKey: IKALZAKZWHFNIC-JIZZDEOASA-L.
| Molecular formula | C4H5K2NO4 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | dipotassium;(2S)-2-aminobutanedioate |
| InChIKey | IKALZAKZWHFNIC-JIZZDEOASA-L |
| SMILES | C([C@@H](C(=O)[O-])N)C(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)
Synonyms:
Dipotassium aspartate, L-Aspartic acid, dipotassium salt, Aspartic acid, dipotassium salt, L-, Aspartic Acid, Dipotassium Salt, Potassium L-aspartate, Potassium (S)-2-aminosuccinate, L-Aspartic acid, potassium salt, L-Aspartate dipotassium salt, dipotassium;(2S)-2-aminobutanedioate, Aspartic acid, potassium salt