CAS 14434-35-6 appears in our catalog under these names: Potassium 2-aminosuccinate(1:x), 97%, DL-Aspartic acid potassium salt. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
Dipotassium;2-aminobutanedioate (CAS 14434-35-6) is a chemical compound with the molecular formula C4H5K2NO4 and a molecular weight of 209.28 g/mol. IUPAC name: dipotassium;2-aminobutanedioate. InChIKey: IKALZAKZWHFNIC-UHFFFAOYSA-L.
| Molecular formula | C4H5K2NO4 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | dipotassium;2-aminobutanedioate |
| InChIKey | IKALZAKZWHFNIC-UHFFFAOYSA-L |
| SMILES | C(C(C(=O)[O-])N)C(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)