CAS 1401026-79-6 is the registry number for (9R)-9-(2-Pyridinyl)-6-oxaspiro(4.5)decane-9-ethanamine. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 50mg, 5mg, 100mg.
2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine (CAS 1401026-79-6) is a chemical compound with the molecular formula C16H24N2O and a molecular weight of 260.37 g/mol. IUPAC name: 2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine. InChIKey: IJVNQJHHXLTQFV-OAHLLOKOSA-N.
| Molecular formula | C16H24N2O |
|---|---|
| Molecular weight | 260.37 g/mol |
| IUPAC name | 2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine |
| InChIKey | IJVNQJHHXLTQFV-OAHLLOKOSA-N |
| SMILES | C1CCC2(C1)C[C@](CCO2)(CCN)C3=CC=CC=N3 |
Computed by PubChem (NCBI)