CAS 1401087-64-6 is the registry number for (S)-Flurbiprofen Axetil (Mixture of Diastereomers). Offered by: Chemat Brand. Available pack sizes: on request.
1-acetyloxyethyl (2S)-2-(3-fluoro-4-phenylphenyl)propanoate (CAS 1401087-64-6) is a chemical compound with the molecular formula C19H19FO4 and a molecular weight of 330.3 g/mol. IUPAC name: 1-acetyloxyethyl (2S)-2-(3-fluoro-4-phenylphenyl)propanoate. InChIKey: ALIVXCSEERJYHU-NBFOIZRFSA-N.
| Molecular formula | C19H19FO4 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | 1-acetyloxyethyl (2S)-2-(3-fluoro-4-phenylphenyl)propanoate |
| InChIKey | ALIVXCSEERJYHU-NBFOIZRFSA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)OC(C)OC(=O)C |
Computed by PubChem (NCBI)