CAS 2375240-97-2 is the registry number for (R)-Flurbiprofen Axetil (Mixture of Diastereomers). Offered by: Chemat Brand. Available pack sizes: on request.
[(1R)-1-acetyloxyethyl] 2-(3-fluoro-4-phenylphenyl)propanoate (CAS 2375240-97-2) is a chemical compound with the molecular formula C19H19FO4 and a molecular weight of 330.3 g/mol. IUPAC name: [(1R)-1-acetyloxyethyl] 2-(3-fluoro-4-phenylphenyl)propanoate. InChIKey: ALIVXCSEERJYHU-TYZXPVIJSA-N.
| Molecular formula | C19H19FO4 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | [(1R)-1-acetyloxyethyl] 2-(3-fluoro-4-phenylphenyl)propanoate |
| InChIKey | ALIVXCSEERJYHU-TYZXPVIJSA-N |
| SMILES | C[C@H](OC(=O)C)OC(=O)C(C)C1=CC(=C(C=C1)C2=CC=CC=C2)F |
Computed by PubChem (NCBI)