CAS 1401668-76-5 is the registry number for N-((R)-1-((S)-2-Aminopropanoyl)pyrrolidin-3-yl)-N-methylacetamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(3R)-1-[(2S)-2-aminopropanoyl]pyrrolidin-3-yl]-N-methylacetamide (CAS 1401668-76-5) is a chemical compound with the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. IUPAC name: N-[(3R)-1-[(2S)-2-aminopropanoyl]pyrrolidin-3-yl]-N-methylacetamide. InChIKey: PWAIAHKBKLXWJJ-IONNQARKSA-N.
| Molecular formula | C10H19N3O2 |
|---|---|
| Molecular weight | 213.28 g/mol |
| IUPAC name | N-[(3R)-1-[(2S)-2-aminopropanoyl]pyrrolidin-3-yl]-N-methylacetamide |
| InChIKey | PWAIAHKBKLXWJJ-IONNQARKSA-N |
| SMILES | C[C@@H](C(=O)N1CC[C@H](C1)N(C)C(=O)C)N |
Computed by PubChem (NCBI)