CAS 1824355-51-2 is the registry number for 6-Azido-1,1-dimethylethylester Hexanoic Acid. Offered by: TRC. Available pack sizes: 250mg.
Tert-butyl 6-azidohexanoate (CAS 1824355-51-2) is a chemical compound with the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. IUPAC name: tert-butyl 6-azidohexanoate. InChIKey: BOOCNADAVBSFCT-UHFFFAOYSA-N.
| Molecular formula | C10H19N3O2 |
|---|---|
| Molecular weight | 213.28 g/mol |
| IUPAC name | tert-butyl 6-azidohexanoate |
| InChIKey | BOOCNADAVBSFCT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)