Products 1401669-02-0
CAS 1401669-02-0 is the registry number for tert-Butyl ((S)-1-((S)-2-aminopropanoyl)pyrrolidin-3-yl)(methyl)carbamate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3S)-1-[(2S)-2-aminopropanoyl]pyrrolidin-3-yl]-N-methylcarbamate (CAS 1401669-02-0) is a chemical compound with the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. IUPAC name: tert-butyl N-[(3S)-1-[(2S)-2-aminopropanoyl]pyrrolidin-3-yl]-N-methylcarbamate. InChIKey: BNKZLILNRMCUAU-UWVGGRQHSA-N.
| Molecular formula | C13H25N3O3 |
|---|---|
| Molecular weight | 271.36 g/mol |
| IUPAC name | tert-butyl N-[(3S)-1-[(2S)-2-aminopropanoyl]pyrrolidin-3-yl]-N-methylcarbamate |
| InChIKey | BNKZLILNRMCUAU-UWVGGRQHSA-N |
| SMILES | C[C@@H](C(=O)N1CC[C@@H](C1)N(C)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)