CAS 2382589-67-3 is the registry number for tert-Butyl (1-((2S,5R)-5-(methylcarbamoyl)pyrrolidin-2-yl)ethyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[1-[(2S,5R)-5-(methylcarbamoyl)pyrrolidin-2-yl]ethyl]carbamate (CAS 2382589-67-3) is a chemical compound with the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. IUPAC name: tert-butyl N-[1-[(2S,5R)-5-(methylcarbamoyl)pyrrolidin-2-yl]ethyl]carbamate. InChIKey: LLLWWHZRPRPLNN-CBMCFHRWSA-N.
| Molecular formula | C13H25N3O3 |
|---|---|
| Molecular weight | 271.36 g/mol |
| IUPAC name | tert-butyl N-[1-[(2S,5R)-5-(methylcarbamoyl)pyrrolidin-2-yl]ethyl]carbamate |
| InChIKey | LLLWWHZRPRPLNN-CBMCFHRWSA-N |
| SMILES | CC([C@@H]1CC[C@@H](N1)C(=O)NC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)