CAS 1401934-53-9 is the registry number for 4-(3,4-Dimethoxyphenyl)-5-phenylthiazol-2-amine, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(3,4-dimethoxyphenyl)-5-phenyl-1,3-thiazol-2-amine (CAS 1401934-53-9) is a chemical compound with the molecular formula C17H16N2O2S and a molecular weight of 312.4 g/mol. IUPAC name: 4-(3,4-dimethoxyphenyl)-5-phenyl-1,3-thiazol-2-amine. InChIKey: ZSFQEPMICSQYIG-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O2S |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 4-(3,4-dimethoxyphenyl)-5-phenyl-1,3-thiazol-2-amine |
| InChIKey | ZSFQEPMICSQYIG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(SC(=N2)N)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)