CAS 141692-09-3 is the registry number for 3-(4-(dimethylamino)phenyl)-2-(phenylsulfonyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-2-(benzenesulfonyl)-3-[4-(dimethylamino)phenyl]prop-2-enenitrile (CAS 141692-09-3) is a chemical compound with the molecular formula C17H16N2O2S and a molecular weight of 312.4 g/mol. IUPAC name: (E)-2-(benzenesulfonyl)-3-[4-(dimethylamino)phenyl]prop-2-enenitrile. InChIKey: AAUVHFGZCIDXOE-SFQUDFHCSA-N.
| Molecular formula | C17H16N2O2S |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (E)-2-(benzenesulfonyl)-3-[4-(dimethylamino)phenyl]prop-2-enenitrile |
| InChIKey | AAUVHFGZCIDXOE-SFQUDFHCSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C(\C#N)/S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)