CAS 1401992-28-6 is the registry number for 4-Bromo-3-chlorothiophene-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
4-bromo-3-chlorothiophene-2-carboxylic acid (CAS 1401992-28-6) is a chemical compound with the molecular formula C5H2BrClO2S and a molecular weight of 241.49 g/mol. IUPAC name: 4-bromo-3-chlorothiophene-2-carboxylic acid. InChIKey: KKVQEKKMAKSARR-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClO2S |
|---|---|
| Molecular weight | 241.49 g/mol |
| IUPAC name | 4-bromo-3-chlorothiophene-2-carboxylic acid |
| InChIKey | KKVQEKKMAKSARR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(S1)C(=O)O)Cl)Br |
Computed by PubChem (NCBI)