CAS 2150373-98-9 is the registry number for 5-Bromo-4-chlorothiophene-3-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
5-bromo-4-chlorothiophene-3-carboxylic acid (CAS 2150373-98-9) is a chemical compound with the molecular formula C5H2BrClO2S and a molecular weight of 241.49 g/mol. IUPAC name: 5-bromo-4-chlorothiophene-3-carboxylic acid. InChIKey: VBYYSQWTPZHGLT-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClO2S |
|---|---|
| Molecular weight | 241.49 g/mol |
| IUPAC name | 5-bromo-4-chlorothiophene-3-carboxylic acid |
| InChIKey | VBYYSQWTPZHGLT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(S1)Br)Cl)C(=O)O |
Computed by PubChem (NCBI)