CAS 1402076-28-1 is the registry number for (2S,4S)-2-(1,1-Dimethylethyl)-4-methyl-1,3-oxathiolan-5-one. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
(2S,4S)-2-tert-butyl-4-methyl-1,3-oxathiolan-5-one (CAS 1402076-28-1) is a chemical compound with the molecular formula C8H14O2S and a molecular weight of 174.26 g/mol. IUPAC name: (2S,4S)-2-tert-butyl-4-methyl-1,3-oxathiolan-5-one. InChIKey: BBCNMYQDVCRBRW-FSPLSTOPSA-N.
| Molecular formula | C8H14O2S |
|---|---|
| Molecular weight | 174.26 g/mol |
| IUPAC name | (2S,4S)-2-tert-butyl-4-methyl-1,3-oxathiolan-5-one |
| InChIKey | BBCNMYQDVCRBRW-FSPLSTOPSA-N |
| SMILES | C[C@H]1C(=O)O[C@@H](S1)C(C)(C)C |
Computed by PubChem (NCBI)