Products 214153-53-4

CAS 214153-53-4 is the registry number for (S)-O-((Tetrahydro-2H-pyran-2-yl)methyl) ethanethioate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

O-[[(2S)-oxan-2-yl]methyl] ethanethioate (CAS 214153-53-4) is a chemical compound with the molecular formula C8H14O2S and a molecular weight of 174.26 g/mol. IUPAC name: O-[[(2S)-oxan-2-yl]methyl] ethanethioate. InChIKey: OLDVUZRJLJKNNM-QMMMGPOBSA-N.

Identity
Molecular formulaC8H14O2S
Molecular weight174.26 g/mol
IUPAC nameO-[[(2S)-oxan-2-yl]methyl] ethanethioate
InChIKeyOLDVUZRJLJKNNM-QMMMGPOBSA-N
SMILESCC(=S)OC[C@@H]1CCCCO1

Computed by PubChem (NCBI)