CAS 1402210-65-4 is the registry number for (Z)-1-(2-(4'-Bromophenyl)hydrazono)-1-chloropropan-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1Z)-N-(4-bromophenyl)-2-oxopropanehydrazonoyl chloride (CAS 1402210-65-4) is a chemical compound with the molecular formula C9H8BrClN2O and a molecular weight of 275.53 g/mol. IUPAC name: (1Z)-N-(4-bromophenyl)-2-oxopropanehydrazonoyl chloride. InChIKey: KNZABGDOPMGFMU-LCYFTJDESA-N.
| Molecular formula | C9H8BrClN2O |
|---|---|
| Molecular weight | 275.53 g/mol |
| IUPAC name | (1Z)-N-(4-bromophenyl)-2-oxopropanehydrazonoyl chloride |
| InChIKey | KNZABGDOPMGFMU-LCYFTJDESA-N |
| SMILES | CC(=O)/C(=N/NC1=CC=C(C=C1)Br)/Cl |
Computed by PubChem (NCBI)