Products 2525205-74-5
CAS 2525205-74-5 is the registry number for 7-Bromo-6-chloro-1,2,3,4-tetrahydro-5H-benzo[e][1,4]diazepin-5-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-6-chloro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one (CAS 2525205-74-5) is a chemical compound with the molecular formula C9H8BrClN2O and a molecular weight of 275.53 g/mol. IUPAC name: 7-bromo-6-chloro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one. InChIKey: SFAQHXGNADDLCX-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClN2O |
|---|---|
| Molecular weight | 275.53 g/mol |
| IUPAC name | 7-bromo-6-chloro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
| InChIKey | SFAQHXGNADDLCX-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C(N1)C=CC(=C2Cl)Br |
Computed by PubChem (NCBI)