Products 140223-15-0

CAS 140223-15-0 is the registry number for 1,2,3,4-Tetra-O-benzoyl-L-fucopyranose. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 25 mg, 50 mg, 250 mg, 100 mg.

Structural formula: {0} (CAS {1})

[(2S,3R,4R,5S)-4,5,6-tribenzoyloxy-2-methyloxan-3-yl] benzoate (CAS 140223-15-0) is a chemical compound with the molecular formula C34H28O9 and a molecular weight of 580.6 g/mol. IUPAC name: [(2S,3R,4R,5S)-4,5,6-tribenzoyloxy-2-methyloxan-3-yl] benzoate. InChIKey: RLJCRSFLYYQNAK-IMLHYIKCSA-N.

Identity
Molecular formulaC34H28O9
Molecular weight580.6 g/mol
IUPAC name[(2S,3R,4R,5S)-4,5,6-tribenzoyloxy-2-methyloxan-3-yl] benzoate
InChIKeyRLJCRSFLYYQNAK-IMLHYIKCSA-N
SMILESC[C@H]1[C@H]([C@H]([C@@H](C(O1)OC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5

Computed by PubChem (NCBI)