CAS 30361-19-4 is the registry number for Sofosbuvir Impurity 88. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4R)-3,4,5-tribenzoyloxy-4-methyloxolan-2-yl]methyl benzoate (CAS 30361-19-4) is a chemical compound with the molecular formula C34H28O9 and a molecular weight of 580.6 g/mol. IUPAC name: [(2R,3R,4R)-3,4,5-tribenzoyloxy-4-methyloxolan-2-yl]methyl benzoate. InChIKey: QJZSLTLDMBDKOU-OSVDXEOTSA-N.
| Molecular formula | C34H28O9 |
|---|---|
| Molecular weight | 580.6 g/mol |
| IUPAC name | [(2R,3R,4R)-3,4,5-tribenzoyloxy-4-methyloxolan-2-yl]methyl benzoate |
| InChIKey | QJZSLTLDMBDKOU-OSVDXEOTSA-N |
| SMILES | C[C@]1([C@@H]([C@H](OC1OC(=O)C2=CC=CC=C2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)