Products 1402568-43-7

CAS 1402568-43-7 is the registry number for 2-(4-Fluorophenyl)-1,2,3,4-tetrahydroquinoline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-(4-fluorophenyl)-1,2,3,4-tetrahydroquinoline (CAS 1402568-43-7) is a chemical compound with the molecular formula C15H14FN and a molecular weight of 227.28 g/mol. IUPAC name: 2-(4-fluorophenyl)-1,2,3,4-tetrahydroquinoline. InChIKey: BMILSASPAVFJPX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14FN
Molecular weight227.28 g/mol
IUPAC name2-(4-fluorophenyl)-1,2,3,4-tetrahydroquinoline
InChIKeyBMILSASPAVFJPX-UHFFFAOYSA-N
SMILESC1CC2=CC=CC=C2NC1C3=CC=C(C=C3)F

Computed by PubChem (NCBI)