CAS 198879-69-5 is the registry number for 3,4-Dimethyl-n-(4-fluorobenzylidene)aniline, 97%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-(3,4-dimethylphenyl)-1-(4-fluorophenyl)methanimine (CAS 198879-69-5) is a chemical compound with the molecular formula C15H14FN and a molecular weight of 227.28 g/mol. IUPAC name: N-(3,4-dimethylphenyl)-1-(4-fluorophenyl)methanimine. InChIKey: HBEHYGAVDFVSNN-UHFFFAOYSA-N.
| Molecular formula | C15H14FN |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | N-(3,4-dimethylphenyl)-1-(4-fluorophenyl)methanimine |
| InChIKey | HBEHYGAVDFVSNN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N=CC2=CC=C(C=C2)F)C |
Computed by PubChem (NCBI)