CAS 1402572-70-6 is the registry number for 2–(2–Nitro–4–ethyl–5–thiophenylphenyl)propanol. Offered by: GLPBio. Available pack sizes: 250mg.
2-(4-ethyl-2-nitro-5-phenylsulfanylphenyl)propan-1-ol (CAS 1402572-70-6) is a chemical compound with the molecular formula C17H19NO3S and a molecular weight of 317.4 g/mol. IUPAC name: 2-(4-ethyl-2-nitro-5-phenylsulfanylphenyl)propan-1-ol. InChIKey: GJXLLKKBXSUWHW-UHFFFAOYSA-N.
| Molecular formula | C17H19NO3S |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | 2-(4-ethyl-2-nitro-5-phenylsulfanylphenyl)propan-1-ol |
| InChIKey | GJXLLKKBXSUWHW-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1SC2=CC=CC=C2)C(C)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)