CAS 33301-41-6 appears in our catalog under these names: 1–Benzhydryl–3–azetidinyl methanesulfonate, 1-Benzhydrylazetidin-3-yl methanesulfonate, 97%, 97%, 1-(Diphenylmethyl)-3-(methanesulfonyloxy)azetidine, 95%, 1-Benzhydrylazetidin-3-yl methanesulfonate, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 500g.
(1-benzhydrylazetidin-3-yl) methanesulfonate (CAS 33301-41-6) is a chemical compound with the molecular formula C17H19NO3S and a molecular weight of 317.4 g/mol. IUPAC name: (1-benzhydrylazetidin-3-yl) methanesulfonate. InChIKey: MSVZMUILYMLJCF-UHFFFAOYSA-N.
| Molecular formula | C17H19NO3S |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | (1-benzhydrylazetidin-3-yl) methanesulfonate |
| InChIKey | MSVZMUILYMLJCF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1CN(C1)C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)