CAS 1402603-45-5 is the registry number for 5H-Imidazo[1,2-c]pyrido[3,4-e][1,3]oxazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-oxa-3,6,12-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaene (CAS 1402603-45-5) is a chemical compound with the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. IUPAC name: 8-oxa-3,6,12-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaene. InChIKey: JKOXUFLQVDSVCD-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 8-oxa-3,6,12-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaene |
| InChIKey | JKOXUFLQVDSVCD-UHFFFAOYSA-N |
| SMILES | C1N2C=CN=C2C3=C(O1)C=CN=C3 |
Computed by PubChem (NCBI)