CAS 1402751-73-8 appears in our catalog under these names: Olprinone Impurity 3, Olprinone Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
5-imidazo[1,2-a]pyridin-6-yl-6-methyl-2-oxo-1H-pyridine-3-carboxylic acid (CAS 1402751-73-8) is a chemical compound with the molecular formula C14H11N3O3 and a molecular weight of 269.25 g/mol. IUPAC name: 5-imidazo[1,2-a]pyridin-6-yl-6-methyl-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: OHIMPNVYDDTKSU-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O3 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | 5-imidazo[1,2-a]pyridin-6-yl-6-methyl-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | OHIMPNVYDDTKSU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=O)N1)C(=O)O)C2=CN3C=CN=C3C=C2 |
Computed by PubChem (NCBI)