Products 1403483-85-1
CAS 1403483-85-1 is the registry number for 4-Bromo-5-methanesulfonyl-2-(trifluoromethoxy)aniline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 1g, 5g, 500g.
4-bromo-5-methylsulfonyl-2-(trifluoromethoxy)aniline (CAS 1403483-85-1) is a chemical compound with the molecular formula C8H7BrF3NO3S and a molecular weight of 334.11 g/mol. IUPAC name: 4-bromo-5-methylsulfonyl-2-(trifluoromethoxy)aniline. InChIKey: XJNVZPSQAABQFN-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3NO3S |
|---|---|
| Molecular weight | 334.11 g/mol |
| IUPAC name | 4-bromo-5-methylsulfonyl-2-(trifluoromethoxy)aniline |
| InChIKey | XJNVZPSQAABQFN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C(=C1)N)OC(F)(F)F)Br |
Computed by PubChem (NCBI)