Products 2792169-10-7
CAS 2792169-10-7 is the registry number for (5-Bromo-3-(trifluoromethyl)pyridin-2-yl)methyl methanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[5-bromo-3-(trifluoromethyl)-2-pyridinyl]methyl methanesulfonate (CAS 2792169-10-7) is a chemical compound with the molecular formula C8H7BrF3NO3S and a molecular weight of 334.11 g/mol. IUPAC name: [5-bromo-3-(trifluoromethyl)-2-pyridinyl]methyl methanesulfonate. InChIKey: FLGIKSXRDJVJPW-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3NO3S |
|---|---|
| Molecular weight | 334.11 g/mol |
| IUPAC name | [5-bromo-3-(trifluoromethyl)-2-pyridinyl]methyl methanesulfonate |
| InChIKey | FLGIKSXRDJVJPW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCC1=C(C=C(C=N1)Br)C(F)(F)F |
Computed by PubChem (NCBI)