Products 1403568-21-7
CAS 1403568-21-7 is the registry number for 3-(4-Chloro-2-methylphenyl)propiolic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-chloro-2-methylphenyl)prop-2-ynoic acid (CAS 1403568-21-7) is a chemical compound with the molecular formula C10H7ClO2 and a molecular weight of 194.61 g/mol. IUPAC name: 3-(4-chloro-2-methylphenyl)prop-2-ynoic acid. InChIKey: XPEHNKMJZOTYES-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO2 |
|---|---|
| Molecular weight | 194.61 g/mol |
| IUPAC name | 3-(4-chloro-2-methylphenyl)prop-2-ynoic acid |
| InChIKey | XPEHNKMJZOTYES-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C#CC(=O)O |
Computed by PubChem (NCBI)