CAS 2256-86-2 appears in our catalog under these names: 3–Methylbenzofuran–2–carbonyl chloride, 3-Methylbenzofuran-2-carbonyl chloride, 95%, 3-Methylbenzofuran-2-carbonyl chloride, 97%. Offered by: GLPBio, Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
3-methyl-1-benzofuran-2-carbonyl chloride (CAS 2256-86-2) is a chemical compound with the molecular formula C10H7ClO2 and a molecular weight of 194.61 g/mol. IUPAC name: 3-methyl-1-benzofuran-2-carbonyl chloride. InChIKey: QEULGCOIYWPYIL-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO2 |
|---|---|
| Molecular weight | 194.61 g/mol |
| IUPAC name | 3-methyl-1-benzofuran-2-carbonyl chloride |
| InChIKey | QEULGCOIYWPYIL-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=CC=CC=C12)C(=O)Cl |
Computed by PubChem (NCBI)