Products 1403693-21-9
CAS 1403693-21-9 appears in our catalog under these names: Fmoc-L-Penicillamine, 97.05%, Fmoc-L-Penicillamine, 98%, Fmoc-3,3-DiMe-Cys-OH, 98%. Offered by: MedChemExpress, Fluorochem, Ambeed. Available pack sizes: Get quote, 100mg, 250mg, 1g, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-sulfanylbutanoic acid (CAS 1403693-21-9) is a chemical compound with the molecular formula C20H21NO4S and a molecular weight of 371.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-sulfanylbutanoic acid. InChIKey: CMNKJRDKAIALPY-QGZVFWFLSA-N.
| Molecular formula | C20H21NO4S |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-sulfanylbutanoic acid |
| InChIKey | CMNKJRDKAIALPY-QGZVFWFLSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)S |
Computed by PubChem (NCBI)