Products 502692-58-2
CAS 502692-58-2 appears in our catalog under these names: L-Methionine-d3-N-FMOC (S-methyl-d3), 98 atom % D, min 97% Chemical Purity, Fmoc–Met–OH–d3, Fmoc-Met-OH-d3, 97.31%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 25mg, 10 mg, 25 mg, 5 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(trideuteriomethylsulfanyl)butanoic acid (CAS 502692-58-2) is a chemical compound with the molecular formula C20H21NO4S and a molecular weight of 374.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(trideuteriomethylsulfanyl)butanoic acid. InChIKey: BUBGAUHBELNDEW-CAGSJYCBSA-N.
| Molecular formula | C20H21NO4S |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(trideuteriomethylsulfanyl)butanoic acid |
| InChIKey | BUBGAUHBELNDEW-CAGSJYCBSA-N |
| SMILES | [2H]C([2H])([2H])SCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-Met-OH-d3