CAS 1403763-26-7 appears in our catalog under these names: (3R)-1-(3-Azetidinyl)-3-fluoro-pyrrolidine dihydrochloride, 95%, (R)-1-(Azetidin-3-yl)-3-fluoropyrrolidine dihydrochloride, 97%, (3R)-1-(3-azetidinyl)-3-fluoro-pyrrolidine dihydrochloride, 97%, 97%, (3R)-1-(azetidin-3-yl)-3-fluoropyrrolidine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 500mg.
(3R)-1-(azetidin-3-yl)-3-fluoropyrrolidine;dihydrochloride (CAS 1403763-26-7) is a chemical compound with the molecular formula C7H15Cl2FN2 and a molecular weight of 217.11 g/mol. IUPAC name: (3R)-1-(azetidin-3-yl)-3-fluoropyrrolidine;dihydrochloride. InChIKey: ZXAPTFRGTLQEMJ-QYCVXMPOSA-N.
| Molecular formula | C7H15Cl2FN2 |
|---|---|
| Molecular weight | 217.11 g/mol |
| IUPAC name | (3R)-1-(azetidin-3-yl)-3-fluoropyrrolidine;dihydrochloride |
| InChIKey | ZXAPTFRGTLQEMJ-QYCVXMPOSA-N |
| SMILES | C1CN(C[C@@H]1F)C2CNC2.Cl.Cl |
Computed by PubChem (NCBI)