Products 2918775-76-3
CAS 2918775-76-3 is the registry number for (7R,8aS)-7-Fluorooctahydropyrrolo[1,2-a]pyrazine dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(7R,8aS)-7-fluoro-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine;dihydrochloride (CAS 2918775-76-3) is a chemical compound with the molecular formula C7H15Cl2FN2 and a molecular weight of 217.11 g/mol. IUPAC name: (7R,8aS)-7-fluoro-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine;dihydrochloride. InChIKey: QEPKJBTUTOXIBN-VJBFUYBPSA-N.
| Molecular formula | C7H15Cl2FN2 |
|---|---|
| Molecular weight | 217.11 g/mol |
| IUPAC name | (7R,8aS)-7-fluoro-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine;dihydrochloride |
| InChIKey | QEPKJBTUTOXIBN-VJBFUYBPSA-N |
| SMILES | C1CN2C[C@@H](C[C@H]2CN1)F.Cl.Cl |
Computed by PubChem (NCBI)