CAS 1403834-71-8 appears in our catalog under these names: Fmoc-d-ala(3-cl)-oh, 95%, Fmoc-D-Ala(3-Cl)-OH. Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 10g, 5g, 1g, 500mg, 25g.
(2S)-3-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1403834-71-8) is a chemical compound with the molecular formula C18H16ClNO4 and a molecular weight of 345.8 g/mol. IUPAC name: (2S)-3-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: NICWPULFDZCIBU-MRXNPFEDSA-N.
| Molecular formula | C18H16ClNO4 |
|---|---|
| Molecular weight | 345.8 g/mol |
| IUPAC name | (2S)-3-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | NICWPULFDZCIBU-MRXNPFEDSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCl)C(=O)O |
Computed by PubChem (NCBI)