CAS 212651-52-0 appears in our catalog under these names: Fmoc-beta-chloro-l-alanine, 95%, Fmoc–beta–chloro–L–alanine, Fmoc-L-Ala(3-Cl)-OH, Fmoc-β-Cl-Ala-OH 95%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-chloropropanoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 50mg, 5g, 25g, 500mg, 100mg, 10g.
(2R)-3-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 212651-52-0) is a chemical compound with the molecular formula C18H16ClNO4 and a molecular weight of 345.8 g/mol. IUPAC name: (2R)-3-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: NICWPULFDZCIBU-INIZCTEOSA-N.
| Molecular formula | C18H16ClNO4 |
|---|---|
| Molecular weight | 345.8 g/mol |
| IUPAC name | (2R)-3-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | NICWPULFDZCIBU-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCl)C(=O)O |
Computed by PubChem (NCBI)