Products 1403967-63-4

CAS 1403967-63-4 is the registry number for 3-Bromopyridine-2-carboxylic acid hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 100g, 5g.

Structural formula: {0} (CAS {1})

3-bromopyridine-2-carboxylic acid;hydrochloride (CAS 1403967-63-4) is a chemical compound with the molecular formula C6H5BrClNO2 and a molecular weight of 238.46 g/mol. IUPAC name: 3-bromopyridine-2-carboxylic acid;hydrochloride. InChIKey: TVGMINLRJVVAJO-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BrClNO2
Molecular weight238.46 g/mol
IUPAC name3-bromopyridine-2-carboxylic acid;hydrochloride
InChIKeyTVGMINLRJVVAJO-UHFFFAOYSA-N
SMILESC1=CC(=C(N=C1)C(=O)O)Br.Cl

Computed by PubChem (NCBI)