CAS 1403967-63-4 is the registry number for 3-Bromopyridine-2-carboxylic acid hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 100g, 5g.
3-bromopyridine-2-carboxylic acid;hydrochloride (CAS 1403967-63-4) is a chemical compound with the molecular formula C6H5BrClNO2 and a molecular weight of 238.46 g/mol. IUPAC name: 3-bromopyridine-2-carboxylic acid;hydrochloride. InChIKey: TVGMINLRJVVAJO-UHFFFAOYSA-N.
| Molecular formula | C6H5BrClNO2 |
|---|---|
| Molecular weight | 238.46 g/mol |
| IUPAC name | 3-bromopyridine-2-carboxylic acid;hydrochloride |
| InChIKey | TVGMINLRJVVAJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=O)O)Br.Cl |
Computed by PubChem (NCBI)