Products 907545-39-5

CAS 907545-39-5 is the registry number for 4-Bromo-3-chloro-5-methyl-1H-pyrrole-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-bromo-3-chloro-5-methyl-1H-pyrrole-2-carboxylic acid (CAS 907545-39-5) is a chemical compound with the molecular formula C6H5BrClNO2 and a molecular weight of 238.46 g/mol. IUPAC name: 4-bromo-3-chloro-5-methyl-1H-pyrrole-2-carboxylic acid. InChIKey: SSYLMVWBDKWAKS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BrClNO2
Molecular weight238.46 g/mol
IUPAC name4-bromo-3-chloro-5-methyl-1H-pyrrole-2-carboxylic acid
InChIKeySSYLMVWBDKWAKS-UHFFFAOYSA-N
SMILESCC1=C(C(=C(N1)C(=O)O)Cl)Br

Computed by PubChem (NCBI)