Products 1404060-15-6
CAS 1404060-15-6 is the registry number for D-Cl-amidine. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(2R)-1-amino-5-[(1-amino-2-chloroethylidene)amino]-1-oxopentan-2-yl]benzamide (CAS 1404060-15-6) is a chemical compound with the molecular formula C14H19ClN4O2 and a molecular weight of 310.78 g/mol. IUPAC name: N-[(2R)-1-amino-5-[(1-amino-2-chloroethylidene)amino]-1-oxopentan-2-yl]benzamide. InChIKey: BPWATVWOHQZVRP-LLVKDONJSA-N.
| Molecular formula | C14H19ClN4O2 |
|---|---|
| Molecular weight | 310.78 g/mol |
| IUPAC name | N-[(2R)-1-amino-5-[(1-amino-2-chloroethylidene)amino]-1-oxopentan-2-yl]benzamide |
| InChIKey | BPWATVWOHQZVRP-LLVKDONJSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@H](CCCN=C(CCl)N)C(=O)N |
Computed by PubChem (NCBI)