Products 2446913-97-7
CAS 2446913-97-7 appears in our catalog under these names: 1-(4-PIPERAZIN-1-YLPHENYL)-1,3-DIAZINAN&, 1-(4-Piperazin-1-ylphenyl)hexahydropyrimidine-2,4-dione hydrochloride, 98%, 98%, CRBN ligand-704, 99.50%, 1-(4-(Piperazin-1-yl)phenyl)dihydropyrimidine-2,4(1H,3H)-dione hydrochloride, 98%. Offered by: Sigma-Aldrich, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 50MG, 100mg, 500 mg, 250 mg, 1 g, 100 mg, 50 mg, 250mg.
1-(4-piperazin-1-ylphenyl)-1,3-diazinane-2,4-dione;hydrochloride (CAS 2446913-97-7) is a chemical compound with the molecular formula C14H19ClN4O2 and a molecular weight of 310.78 g/mol. IUPAC name: 1-(4-piperazin-1-ylphenyl)-1,3-diazinane-2,4-dione;hydrochloride. InChIKey: XPOUFTXRXQNLKJ-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN4O2 |
|---|---|
| Molecular weight | 310.78 g/mol |
| IUPAC name | 1-(4-piperazin-1-ylphenyl)-1,3-diazinane-2,4-dione;hydrochloride |
| InChIKey | XPOUFTXRXQNLKJ-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC=C(C=C2)N3CCNCC3.Cl |
Computed by PubChem (NCBI)