CAS 140411-19-4 is the registry number for 1-(tert-Butyl)-3-(2,6-diisopropylphenyl)urea, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-tert-butyl-3-[2,6-di(propan-2-yl)phenyl]urea (CAS 140411-19-4) is a chemical compound with the molecular formula C17H28N2O and a molecular weight of 276.4 g/mol. IUPAC name: 1-tert-butyl-3-[2,6-di(propan-2-yl)phenyl]urea. InChIKey: MMWHJSBSKFLYSN-UHFFFAOYSA-N.
| Molecular formula | C17H28N2O |
|---|---|
| Molecular weight | 276.4 g/mol |
| IUPAC name | 1-tert-butyl-3-[2,6-di(propan-2-yl)phenyl]urea |
| InChIKey | MMWHJSBSKFLYSN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)NC(=O)NC(C)(C)C |
Computed by PubChem (NCBI)