CAS 2760267-35-2 is the registry number for N,N-Dimethyl-1-(3-((2R,5S)-5-methylpiperidin-2-yl)phenoxy)propan-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-dimethyl-1-[3-[(2R,5S)-5-methylpiperidin-2-yl]phenoxy]propan-2-amine (CAS 2760267-35-2) is a chemical compound with the molecular formula C17H28N2O and a molecular weight of 276.4 g/mol. IUPAC name: N,N-dimethyl-1-[3-[(2R,5S)-5-methylpiperidin-2-yl]phenoxy]propan-2-amine. InChIKey: BWMKGNNUKLTPCD-BHVXPOTESA-N.
| Molecular formula | C17H28N2O |
|---|---|
| Molecular weight | 276.4 g/mol |
| IUPAC name | N,N-dimethyl-1-[3-[(2R,5S)-5-methylpiperidin-2-yl]phenoxy]propan-2-amine |
| InChIKey | BWMKGNNUKLTPCD-BHVXPOTESA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2=CC(=CC=C2)OCC(C)N(C)C |
Computed by PubChem (NCBI)