CAS 1404110-03-7 appears in our catalog under these names: 2-(7-Fluorobenzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%, 2-(7-Fluorobenzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-(7-fluoro-1-benzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1404110-03-7) is a chemical compound with the molecular formula C14H16BFO3 and a molecular weight of 262.09 g/mol. IUPAC name: 2-(7-fluoro-1-benzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LWJZXSBQSSOGSV-UHFFFAOYSA-N.
| Molecular formula | C14H16BFO3 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 2-(7-fluoro-1-benzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LWJZXSBQSSOGSV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C(=C2)F)OC=C3 |
Computed by PubChem (NCBI)