Products 2606971-35-9
CAS 2606971-35-9 appears in our catalog under these names: 2-(7-Fluorobenzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 2-(7-Fluorobenzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
2-(7-fluoro-1-benzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2606971-35-9) is a chemical compound with the molecular formula C14H16BFO3 and a molecular weight of 262.09 g/mol. IUPAC name: 2-(7-fluoro-1-benzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XGDWBHFCMQDIPF-UHFFFAOYSA-N.
| Molecular formula | C14H16BFO3 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 2-(7-fluoro-1-benzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XGDWBHFCMQDIPF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=COC3=C(C=C2)F |
Computed by PubChem (NCBI)