CAS 1404192-74-0 appears in our catalog under these names: Jaboticabin Ethyl Impurity, Desmethyl Jaboticabin Ethyl Carboxylate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
[2-(2-ethoxy-2-oxoethyl)-3,5-dihydroxyphenyl] 3,4-dihydroxybenzoate (CAS 1404192-74-0) is a chemical compound with the molecular formula C17H16O8 and a molecular weight of 348.3 g/mol. IUPAC name: [2-(2-ethoxy-2-oxoethyl)-3,5-dihydroxyphenyl] 3,4-dihydroxybenzoate. InChIKey: QBHCALSNLQCVBQ-UHFFFAOYSA-N.
| Molecular formula | C17H16O8 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | [2-(2-ethoxy-2-oxoethyl)-3,5-dihydroxyphenyl] 3,4-dihydroxybenzoate |
| InChIKey | QBHCALSNLQCVBQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=C(C=C1OC(=O)C2=CC(=C(C=C2)O)O)O)O |
Computed by PubChem (NCBI)